C19H20O5 — CID 44568001
4,5,6-trimethoxy-3-(3-methoxyphenyl)-2,3-dihydroinden-1-one (PubChem CID 44568001) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 4,5,6-trimethoxy-3-(3-methoxyphenyl)-2,3-dihydroinden-1-one.
| Compound Name | 4,5,6-trimethoxy-3-(3-methoxyphenyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 44568001 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4,5,6-trimethoxy-3-(3-methoxyphenyl)-2,3-dihydroinden-1-one |
| SMILES | COc1cccc(C2CC(=O)c3cc(OC)c(OC)c(OC)c32)c1 |
| InChI | InChI=1S/C19H20O5/c1-21-12-7-5-6-11(8-12)13-9-15(20)14-10-16(22-2)18(23-3)19(24-4)17(13)14/h5-8,10,13H,9H2,1-4H3 |
| InChIKey | YKCIDBZNKNPMQE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |