C17H15FO3 — CID 132569592
(3S)-3-(4-fluorophenyl)-4,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 132569592) has the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-4,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | (3S)-3-(4-fluorophenyl)-4,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 132569592 |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-4,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc(OC)c2c(c1)C(=O)C[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FO3/c1-20-12-7-14-15(19)9-13(17(14)16(8-12)21-2)10-3-5-11(18)6-4-10/h3-8,13H,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | BZYRYJWEDSBNGM-ZDUSSCGKSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |