C18H19NO4 — CID 157480286
5,6,7-trimethoxy-4-pyridin-3-yl-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 157480286) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 5,6,7-trimethoxy-4-pyridin-3-yl-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 5,6,7-trimethoxy-4-pyridin-3-yl-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 157480286 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5,6,7-trimethoxy-4-pyridin-3-yl-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | COc1cc2c(c(OC)c1OC)C(c1cccnc1)CC(=O)C2 |
| InChI | InChI=1S/C18H19NO4/c1-21-15-8-12-7-13(20)9-14(11-5-4-6-19-10-11)16(12)18(23-3)17(15)22-2/h4-6,8,10,14H,7,9H2,1-3H3 |
| InChIKey | BWBUSKMZUKSWFP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |