C24H26N2O4 — CID 46956305
(1R,3S)-1-(2,3-dimethoxyphenyl)-6,7-dimethoxy-3-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 46956305) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (1R,3S)-1-(2,3-dimethoxyphenyl)-6,7-dimethoxy-3-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R,3S)-1-(2,3-dimethoxyphenyl)-6,7-dimethoxy-3-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 46956305 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (1R,3S)-1-(2,3-dimethoxyphenyl)-6,7-dimethoxy-3-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H](c1cccc(OC)c1OC)N[C@H](c1cccnc1)C2 |
| InChI | InChI=1S/C24H26N2O4/c1-27-20-9-5-8-17(24(20)30-4)23-18-13-22(29-3)21(28-2)12-16(18)11-19(26-23)15-7-6-10-25-14-15/h5-10,12-14,19,23,26H,11H2,1-4H3/t19-,23-/m0/s1 |
| InChIKey | QSRCYDPUSRCYGA-CVDCTZTESA-N |
| XLogP | 4.09 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |