C19H23NO2 — CID 101228516
(1R,3R)-3-ethyl-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 101228516) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,3R)-3-ethyl-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R,3R)-3-ethyl-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 101228516 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1R,3R)-3-ethyl-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC[C@@H]1Cc2cc(OC)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C19H23NO2/c1-4-15-10-14-11-17(21-2)18(22-3)12-16(14)19(20-15)13-8-6-5-7-9-13/h5-9,11-12,15,19-20H,4,10H2,1-3H3/t15-,19-/m1/s1 |
| InChIKey | NAPSRIAILNMTDQ-DNVCBOLYSA-N |
| XLogP | 3.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |