C24H24N2O2 — CID 135704112
N-benzyl-6,7-dimethoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-imine (PubChem CID 135704112) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-benzyl-6,7-dimethoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-imine.
| Compound Name | N-benzyl-6,7-dimethoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-imine |
|---|---|
| PubChem CID | 135704112 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-benzyl-6,7-dimethoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-imine |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N/C(=N/Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H24N2O2/c1-27-21-13-19-14-23(25-16-17-9-5-3-6-10-17)26-24(18-11-7-4-8-12-18)20(19)15-22(21)28-2/h3-13,15,24H,14,16H2,1-2H3,(H,25,26) |
| InChIKey | LFEJALBCNVPTLK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|