C23H29NO2 — CID 11027336
N-benzyl-4-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-imine (PubChem CID 11027336) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-benzyl-4-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-imine.
| Compound Name | N-benzyl-4-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-imine |
|---|---|
| PubChem CID | 11027336 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-benzyl-4-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-imine |
| SMILES | COc1cc2c(cc1OC)C(CC/C(C)=N/Cc1ccccc1)CCC2 |
| InChI | InChI=1S/C23H29NO2/c1-17(24-16-18-8-5-4-6-9-18)12-13-19-10-7-11-20-14-22(25-2)23(26-3)15-21(19)20/h4-6,8-9,14-15,19H,7,10-13,16H2,1-3H3/b24-17+ |
| InChIKey | DNGZLOLFVJDIMD-JJIBRWJFSA-N |
| XLogP | 5.57 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|