C18H21NO2 — CID 10446565
(2R,4S)-6,7-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10446565) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2R,4S)-6,7-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2R,4S)-6,7-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10446565 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2R,4S)-6,7-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccccc1)C[C@@H](N)C2 |
| InChI | InChI=1S/C18H21NO2/c1-20-17-9-13-8-14(19)10-15(12-6-4-3-5-7-12)16(13)11-18(17)21-2/h3-7,9,11,14-15H,8,10,19H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | PJYVTWYSUIBGGB-GJZGRUSLSA-N |
| XLogP | 3.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |