C23H25NO6-2 — CID 20838253
(Z)-but-2-enedioate;7,8-dimethoxy-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 20838253) has the molecular formula C23H25NO6-2 and a molecular weight of 411.45 g/mol. Its IUPAC name is (Z)-but-2-enedioate;7,8-dimethoxy-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | (Z)-but-2-enedioate;7,8-dimethoxy-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 20838253 |
| Molecular Formula | C23H25NO6-2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (Z)-but-2-enedioate;7,8-dimethoxy-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)CN(C)CC2.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C19H23NO2.C4H4O4/c1-20-10-9-15-11-18(21-2)19(22-3)12-16(15)17(13-20)14-7-5-4-6-8-14;5-3(6)1-2-4(7)8/h4-8,11-12,17H,9-10,13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/p-2/b;2-1- |
| InChIKey | TYNKKGLBKXZIHX-BTJKTKAUSA-L |
| XLogP | 0.37 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|