C22H26ClNO2 — CID 13050694
[(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] pentanoate (PubChem CID 13050694) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is [(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] pentanoate.
| Compound Name | [(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] pentanoate |
|---|---|
| PubChem CID | 13050694 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] pentanoate |
| SMILES | CCCCC(=O)Oc1cc2c(cc1Cl)CCN(C)C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C22H26ClNO2/c1-3-4-10-22(25)26-21-14-18-17(13-20(21)23)11-12-24(2)15-19(18)16-8-6-5-7-9-16/h5-9,13-14,19H,3-4,10-12,15H2,1-2H3/t19-/m0/s1 |
| InChIKey | WLIJGGWIONIGBV-IBGZPJMESA-N |
| XLogP | 5.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|