C22H28ClNO3S — CID 88670462
7-methoxy-3-pentyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-8-sulfonyl chloride (PubChem CID 88670462) has the molecular formula C22H28ClNO3S and a molecular weight of 421.99 g/mol. Its IUPAC name is 7-methoxy-3-pentyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-8-sulfonyl chloride.
| Compound Name | 7-methoxy-3-pentyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-8-sulfonyl chloride |
|---|---|
| PubChem CID | 88670462 |
| Molecular Formula | C22H28ClNO3S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 7-methoxy-3-pentyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-8-sulfonyl chloride |
| SMILES | CCCCCN1CCc2cc(S(=O)(=O)Cl)c(OC)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C22H28ClNO3S/c1-3-4-8-12-24-13-11-18-14-22(28(23,25)26)21(27-2)15-19(18)20(16-24)17-9-6-5-7-10-17/h5-7,9-10,14-15,20H,3-4,8,11-13,16H2,1-2H3 |
| InChIKey | BXMGYEFCTUOSSF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|