C22H37ClN2O2 — CID 46212027
9,10-dimethoxy-2-octyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride (PubChem CID 46212027) has the molecular formula C22H37ClN2O2 and a molecular weight of 397.00 g/mol. Its IUPAC name is 9,10-dimethoxy-2-octyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride.
| Compound Name | 9,10-dimethoxy-2-octyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 46212027 |
| Molecular Formula | C22H37ClN2O2 |
| Molecular Weight | 397.00 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 9,10-dimethoxy-2-octyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride |
| SMILES | CCCCCCCCN1CCN2CCc3cc(OC)c(OC)cc3C2C1.Cl |
| InChI | InChI=1S/C22H36N2O2.ClH/c1-4-5-6-7-8-9-11-23-13-14-24-12-10-18-15-21(25-2)22(26-3)16-19(18)20(24)17-23;/h15-16,20H,4-14,17H2,1-3H3;1H |
| InChIKey | BYTSFSWSSZFHCS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.00 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|