C21H35ClN2 — CID 46212023
2-nonyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride (PubChem CID 46212023) has the molecular formula C21H35ClN2 and a molecular weight of 350.98 g/mol. Its IUPAC name is 2-nonyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride.
| Compound Name | 2-nonyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 46212023 |
| Molecular Formula | C21H35ClN2 |
| Molecular Weight | 350.98 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 2-nonyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;hydrochloride |
| SMILES | CCCCCCCCCN1CCN2CCc3ccccc3C2C1.Cl |
| InChI | InChI=1S/C21H34N2.ClH/c1-2-3-4-5-6-7-10-14-22-16-17-23-15-13-19-11-8-9-12-20(19)21(23)18-22;/h8-9,11-12,21H,2-7,10,13-18H2,1H3;1H |
| InChIKey | MDNYMVCHEACLOD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|