C17H25N3O — CID 110629459
N-butan-2-yl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxamide (PubChem CID 110629459) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-butan-2-yl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxamide.
| Compound Name | N-butan-2-yl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 110629459 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-butan-2-yl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxamide |
| SMILES | CCC(C)NC(=O)N1CCN2CCc3ccccc3C2C1 |
| InChI | InChI=1S/C17H25N3O/c1-3-13(2)18-17(21)20-11-10-19-9-8-14-6-4-5-7-15(14)16(19)12-20/h4-7,13,16H,3,8-12H2,1-2H3,(H,18,21) |
| InChIKey | BXRHKMZAGIOOIF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |