C15H20N2O2 — CID 129137436
(11bR)-9-ethyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylic acid (PubChem CID 129137436) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (11bR)-9-ethyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylic acid.
| Compound Name | (11bR)-9-ethyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 129137436 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (11bR)-9-ethyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylic acid |
| SMILES | CCc1ccc2c(c1)CCN1CCN(C(=O)O)C[C@@H]21 |
| InChI | InChI=1S/C15H20N2O2/c1-2-11-3-4-13-12(9-11)5-6-16-7-8-17(15(18)19)10-14(13)16/h3-4,9,14H,2,5-8,10H2,1H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | RGBYGBOIDHFZOH-AWEZNQCLSA-N |
| XLogP | 2.14 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |