C14H20N2 — CID 134420882
9-ethyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline (PubChem CID 134420882) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 9-ethyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline.
| Compound Name | 9-ethyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 134420882 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 9-ethyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline |
| SMILES | CCc1ccc2c(c1)CCN1CCNCC21 |
| InChI | InChI=1S/C14H20N2/c1-2-11-3-4-13-12(9-11)5-7-16-8-6-15-10-14(13)16/h3-4,9,14-15H,2,5-8,10H2,1H3 |
| InChIKey | MOJVHPWDFIXTTP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |