C19H24N4 — CID 147981289
(11bR)-9-[(5-ethylpyrimidin-2-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline (PubChem CID 147981289) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is (11bR)-9-[(5-ethylpyrimidin-2-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline.
| Compound Name | (11bR)-9-[(5-ethylpyrimidin-2-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 147981289 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (11bR)-9-[(5-ethylpyrimidin-2-yl)methyl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline |
| SMILES | CCc1cnc(Cc2ccc3c(c2)CCN2CCNC[C@@H]32)nc1 |
| InChI | InChI=1S/C19H24N4/c1-2-14-11-21-19(22-12-14)10-15-3-4-17-16(9-15)5-7-23-8-6-20-13-18(17)23/h3-4,9,11-12,18,20H,2,5-8,10,13H2,1H3/t18-/m0/s1 |
| InChIKey | ITGQBQXYOGOWFR-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |