About 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene
5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene (PubChem CID 71777791) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene.
Analyze 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene?
The IUPAC name of 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene (CID 71777791) is 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene.
What is the SMILES notation for 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene?
The canonical SMILES for 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene is c1cc2c(s1)CCN1CCNCC21.
What is the InChIKey of 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene?
The InChIKey is NLRRDRKYIZDCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-4-12-5-3-11-7-9(12)8-2-6-13-10(1)8/h2,6,9,11H,1,3-5,7H2.
What are the key properties of 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene?
5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene has a molecular weight of 194.30 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-thia-9,12-diazatricyclo[7.4.0.02,6]trideca-2(6),3-diene is sourced from PubChem (CID 71777791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).