C10H16N2S — CID 116963174
1-methyl-2-(3-methylthiophen-2-yl)piperazine (PubChem CID 116963174) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-methyl-2-(3-methylthiophen-2-yl)piperazine.
| Compound Name | 1-methyl-2-(3-methylthiophen-2-yl)piperazine |
|---|---|
| PubChem CID | 116963174 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-methyl-2-(3-methylthiophen-2-yl)piperazine |
| SMILES | Cc1ccsc1C1CNCCN1C |
| InChI | InChI=1S/C10H16N2S/c1-8-3-6-13-10(8)9-7-11-4-5-12(9)2/h3,6,9,11H,4-5,7H2,1-2H3 |
| InChIKey | ANYDHWMUJDCMOY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |