C16H24N2O2 — CID 71112848
[(2R,11bS)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanamine (PubChem CID 71112848) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(2R,11bS)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanamine.
| Compound Name | [(2R,11bS)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanamine |
|---|---|
| PubChem CID | 71112848 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | [(2R,11bS)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanamine |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C[C@H](CN)CCN1CC2 |
| InChI | InChI=1S/C16H24N2O2/c1-19-15-8-12-4-6-18-5-3-11(10-17)7-14(18)13(12)9-16(15)20-2/h8-9,11,14H,3-7,10,17H2,1-2H3/t11-,14+/m1/s1 |
| InChIKey | JWNRJDOXJGYPFK-RISCZKNCSA-N |
| XLogP | 1.97 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |