C15H21NO3 — CID 14945904
(2R,11bR)-9,10-dimethoxy-2-methyl-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinoline (PubChem CID 14945904) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (2R,11bR)-9,10-dimethoxy-2-methyl-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinoline.
| Compound Name | (2R,11bR)-9,10-dimethoxy-2-methyl-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinoline |
|---|---|
| PubChem CID | 14945904 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2R,11bR)-9,10-dimethoxy-2-methyl-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](C)OCN1CC2 |
| InChI | InChI=1S/C15H21NO3/c1-10-6-13-12-8-15(18-3)14(17-2)7-11(12)4-5-16(13)9-19-10/h7-8,10,13H,4-6,9H2,1-3H3/t10-,13-/m1/s1 |
| InChIKey | PMGWGUUUODYWST-ZWNOBZJWSA-N |
| XLogP | 2.37 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |