C19H27NO3 — CID 59721543
(1R)-4,5-dimethoxy-12-(2-methylpropyl)-13-oxa-10-azatetracyclo[8.5.0.02,7.012,14]pentadeca-2,4,6-triene (PubChem CID 59721543) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (1R)-4,5-dimethoxy-12-(2-methylpropyl)-13-oxa-10-azatetracyclo[8.5.0.02,7.012,14]pentadeca-2,4,6-triene.
| Compound Name | (1R)-4,5-dimethoxy-12-(2-methylpropyl)-13-oxa-10-azatetracyclo[8.5.0.02,7.012,14]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 59721543 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (1R)-4,5-dimethoxy-12-(2-methylpropyl)-13-oxa-10-azatetracyclo[8.5.0.02,7.012,14]pentadeca-2,4,6-triene |
| SMILES | COc1cc2c(cc1OC)[C@H]1CC3OC3(CC(C)C)CN1CC2 |
| InChI | InChI=1S/C19H27NO3/c1-12(2)10-19-11-20-6-5-13-7-16(21-3)17(22-4)8-14(13)15(20)9-18(19)23-19/h7-8,12,15,18H,5-6,9-11H2,1-4H3/t15-,18?,19?/m1/s1 |
| InChIKey | QWNFDBXELGMFCV-VNCLNFNDSA-N |
| XLogP | 3.19 |
| TPSA | 34.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|