C16H21NO3 — CID 13068849
(2R,11bS)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] (PubChem CID 13068849) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2R,11bS)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane].
| Compound Name | (2R,11bS)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] |
|---|---|
| PubChem CID | 13068849 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2R,11bS)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C[C@]3(CCN1CC2)CO3 |
| InChI | InChI=1S/C16H21NO3/c1-18-14-7-11-3-5-17-6-4-16(10-20-16)9-13(17)12(11)8-15(14)19-2/h7-8,13H,3-6,9-10H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | GYKMHOQTBMONGT-XJKSGUPXSA-N |
| XLogP | 2.17 |
| TPSA | 34.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|