C18H24N2O3 — CID 98535679
(2R,3S,11bS)-3-ethyl-2-hydroxy-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2-carbonitrile (PubChem CID 98535679) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2R,3S,11bS)-3-ethyl-2-hydroxy-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2-carbonitrile.
| Compound Name | (2R,3S,11bS)-3-ethyl-2-hydroxy-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2-carbonitrile |
|---|---|
| PubChem CID | 98535679 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2R,3S,11bS)-3-ethyl-2-hydroxy-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2-carbonitrile |
| SMILES | CC[C@H]1CN2CCc3cc(OC)c(OC)cc3[C@@H]2C[C@]1(O)C#N |
| InChI | InChI=1S/C18H24N2O3/c1-4-13-10-20-6-5-12-7-16(22-2)17(23-3)8-14(12)15(20)9-18(13,21)11-19/h7-8,13,15,21H,4-6,9-10H2,1-3H3/t13-,15-,18-/m0/s1 |
| InChIKey | MDLLTBLACCNBNJ-YEWWUXTCSA-N |
| XLogP | 2.29 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|