C25H27N3O5 — CID 6712258
(2R)-1'-acetyl-9,10-dimethoxy-3'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione (PubChem CID 6712258) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2R)-1'-acetyl-9,10-dimethoxy-3'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | (2R)-1'-acetyl-9,10-dimethoxy-3'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 6712258 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (2R)-1'-acetyl-9,10-dimethoxy-3'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1cc2c(cc1OC)C1C[C@]3(CCN1CC2)C(=O)N(c1ccccc1)C(=O)N3C(C)=O |
| InChI | InChI=1S/C25H27N3O5/c1-16(29)28-24(31)27(18-7-5-4-6-8-18)23(30)25(28)10-12-26-11-9-17-13-21(32-2)22(33-3)14-19(17)20(26)15-25/h4-8,13-14,20H,9-12,15H2,1-3H3/t20?,25-/m1/s1 |
| InChIKey | JAYCKXDLLPVWKA-GBAXHLBXSA-N |
| XLogP | 3.15 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|