C30H32N4O3 — CID 15129969
(2R,11bS)-3'-benzyl-5'-imino-9,10-dimethoxy-1'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,4'-imidazolidine]-2'-one (PubChem CID 15129969) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is (2R,11bS)-3'-benzyl-5'-imino-9,10-dimethoxy-1'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,4'-imidazolidine]-2'-one.
| Compound Name | (2R,11bS)-3'-benzyl-5'-imino-9,10-dimethoxy-1'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,4'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 15129969 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (2R,11bS)-3'-benzyl-5'-imino-9,10-dimethoxy-1'-phenylspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,4'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\N(c2ccccc2)C(=O)N(Cc2ccccc2)[C@@]12CCN1CCc3cc(OC)c(OC)cc3[C@@H]1C2 |
| InChI | InChI=1S/C30H32N4O3/c1-36-26-17-22-13-15-32-16-14-30(19-25(32)24(22)18-27(26)37-2)28(31)34(23-11-7-4-8-12-23)29(35)33(30)20-21-9-5-3-6-10-21/h3-12,17-18,25,31H,13-16,19-20H2,1-2H3/b31-28-/t25-,30+/m0/s1 |
| InChIKey | NTNRKAWPPLMZOR-WPEFSAFWSA-N |
| XLogP | 5.26 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|