C30H30ClN3O4 — CID 15129991
(2R,11bS)-1'-benzyl-3'-(3-chlorophenyl)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione (PubChem CID 15129991) has the molecular formula C30H30ClN3O4 and a molecular weight of 532.04 g/mol. Its IUPAC name is (2R,11bS)-1'-benzyl-3'-(3-chlorophenyl)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | (2R,11bS)-1'-benzyl-3'-(3-chlorophenyl)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 15129991 |
| Molecular Formula | C30H30ClN3O4 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (2R,11bS)-1'-benzyl-3'-(3-chlorophenyl)-9,10-dimethoxyspiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C[C@]3(CCN1CC2)C(=O)N(c1cccc(Cl)c1)C(=O)N3Cc1ccccc1 |
| InChI | InChI=1S/C30H30ClN3O4/c1-37-26-15-21-11-13-32-14-12-30(18-25(32)24(21)17-27(26)38-2)28(35)34(23-10-6-9-22(31)16-23)29(36)33(30)19-20-7-4-3-5-8-20/h3-10,15-17,25H,11-14,18-19H2,1-2H3/t25-,30+/m0/s1 |
| InChIKey | PYZYYZBSFWCHFW-SETSBSEESA-N |
| XLogP | 5.46 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|