C17H22N2O4 — CID 90766204
methyl 2-imino-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 90766204) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 2-imino-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | methyl 2-imino-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 90766204 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl 2-imino-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | [H]/N=C1\CC2c3cc(OC)c(OC)cc3CCN2CC1C(=O)OC |
| InChI | InChI=1S/C17H22N2O4/c1-21-15-6-10-4-5-19-9-12(17(20)23-3)13(18)8-14(19)11(10)7-16(15)22-2/h6-7,12,14,18H,4-5,8-9H2,1-3H3/b18-13+ |
| InChIKey | CBKFHPCNHRDNQO-QGOAFFKASA-N |
| XLogP | 1.82 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|