C21H33NO3 — CID 143088515
9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one;ethane (PubChem CID 143088515) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one;ethane.
| Compound Name | 9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one;ethane |
|---|---|
| PubChem CID | 143088515 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one;ethane |
| SMILES | CC.COc1cc2c(cc1OC)C1CC(=O)C(CC(C)C)CN1CC2 |
| InChI | InChI=1S/C19H27NO3.C2H6/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21;1-2/h8-9,12,14,16H,5-7,10-11H2,1-4H3;1-2H3 |
| InChIKey | ZWSGHNQOKCLKKS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |