C20H30N4O3 — CID 99643481
[(E)-[(3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]urea (PubChem CID 99643481) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is [(E)-[(3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]urea.
| Compound Name | [(E)-[(3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]urea |
|---|---|
| PubChem CID | 99643481 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [(E)-[(3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]urea |
| SMILES | COc1cc2c(cc1OC)[C@H]1C/C(=N\NC(N)=O)[C@@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C20H30N4O3/c1-12(2)7-14-11-24-6-5-13-8-18(26-3)19(27-4)9-15(13)17(24)10-16(14)22-23-20(21)25/h8-9,12,14,17H,5-7,10-11H2,1-4H3,(H3,21,23,25)/b22-16+/t14-,17+/m0/s1 |
| InChIKey | UZYMRVUJWGYPGN-DJZOAUTKSA-N |
| XLogP | 2.69 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|