C25H32N4O3 — CID 51506298
N-[(Z)-[(3S,11bS)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 51506298) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[(Z)-[(3S,11bS)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[(3S,11bS)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 51506298 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[(Z)-[(3S,11bS)-9,10-dimethoxy-3-(2-methylpropyl)-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C/C(=N/NC(=O)c3ccncc3)[C@@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C25H32N4O3/c1-16(2)11-19-15-29-10-7-18-12-23(31-3)24(32-4)13-20(18)22(29)14-21(19)27-28-25(30)17-5-8-26-9-6-17/h5-6,8-9,12-13,16,19,22H,7,10-11,14-15H2,1-4H3,(H,28,30)/b27-21-/t19-,22-/m0/s1 |
| InChIKey | LKWDAVXTJZZGHT-PYJIEWMWSA-N |
| XLogP | 3.85 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|