C22H33NO4 — CID 153375131
[9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl acetate (PubChem CID 153375131) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is [9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl acetate.
| Compound Name | [9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 153375131 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | [9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl acetate |
| SMILES | COc1cc2c(cc1OC)C1CC(COC(C)=O)C(CC(C)C)CN1CC2 |
| InChI | InChI=1S/C22H33NO4/c1-14(2)8-17-12-23-7-6-16-10-21(25-4)22(26-5)11-19(16)20(23)9-18(17)13-27-15(3)24/h10-11,14,17-18,20H,6-9,12-13H2,1-5H3 |
| InChIKey | OPHQPERVHOSSJB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |