C27H42N2O4 — CID 152813696
[9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 3-methylpiperidine-4-carboxylate (PubChem CID 152813696) has the molecular formula C27H42N2O4 and a molecular weight of 458.64 g/mol. Its IUPAC name is [9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 3-methylpiperidine-4-carboxylate.
| Compound Name | [9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 3-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 152813696 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | [9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 3-methylpiperidine-4-carboxylate |
| SMILES | COc1cc2c(cc1OC)C1CC(COC(=O)C3CCNCC3C)C(CC(C)C)CN1CC2 |
| InChI | InChI=1S/C27H42N2O4/c1-17(2)10-20-15-29-9-7-19-12-25(31-4)26(32-5)13-23(19)24(29)11-21(20)16-33-27(30)22-6-8-28-14-18(22)3/h12-13,17-18,20-22,24,28H,6-11,14-16H2,1-5H3 |
| InChIKey | SRWBZSYIWMWDRQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |