C26H40N2O4 — CID 140743832
[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-pyrrolidin-3-ylacetate (PubChem CID 140743832) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-pyrrolidin-3-ylacetate.
| Compound Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-pyrrolidin-3-ylacetate |
|---|---|
| PubChem CID | 140743832 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-pyrrolidin-3-ylacetate |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](COC(=O)CC3CCNC3)[C@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C26H40N2O4/c1-17(2)9-20-15-28-8-6-19-12-24(30-3)25(31-4)13-22(19)23(28)11-21(20)16-32-26(29)10-18-5-7-27-14-18/h12-13,17-18,20-21,23,27H,5-11,14-16H2,1-4H3/t18?,20-,21+,23-/m1/s1 |
| InChIKey | HVRIJOREBUSLIF-WYNJDRFBSA-N |
| XLogP | 3.83 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |