C29H43NO6 — CID 149037895
2-[1-[2-[[9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxy]-2-oxoethyl]cyclopentyl]acetic acid (PubChem CID 149037895) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is 2-[1-[2-[[9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxy]-2-oxoethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-[[9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxy]-2-oxoethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 149037895 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | 2-[1-[2-[[9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxy]-2-oxoethyl]cyclopentyl]acetic acid |
| SMILES | COc1cc2c(cc1OC)C1CC(COC(=O)CC3(CC(=O)O)CCCC3)C(CC(C)C)CN1CC2 |
| InChI | InChI=1S/C29H43NO6/c1-19(2)11-21-17-30-10-7-20-13-25(34-3)26(35-4)14-23(20)24(30)12-22(21)18-36-28(33)16-29(15-27(31)32)8-5-6-9-29/h13-14,19,21-22,24H,5-12,15-18H2,1-4H3,(H,31,32) |
| InChIKey | QGZGVAOYINJFHD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |