C26H40N2O6 — CID 122583913
4-[[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxycarbonyl-methylamino]butanoic acid (PubChem CID 122583913) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is 4-[[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxycarbonyl-methylamino]butanoic acid.
| Compound Name | 4-[[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxycarbonyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 122583913 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 4-[[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methoxycarbonyl-methylamino]butanoic acid |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](COC(=O)N(C)CCCC(=O)O)[C@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C26H40N2O6/c1-17(2)11-19-15-28-10-8-18-13-23(32-4)24(33-5)14-21(18)22(28)12-20(19)16-34-26(31)27(3)9-6-7-25(29)30/h13-14,17,19-20,22H,6-12,15-16H2,1-5H3,(H,29,30)/t19-,20+,22-/m1/s1 |
| InChIKey | VYRHGRIHVGFODU-RZUBCFFCSA-N |
| XLogP | 4.22 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |