C31H42N2O4 — CID 140743836
[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 1-benzylazetidine-3-carboxylate (PubChem CID 140743836) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 1-benzylazetidine-3-carboxylate.
| Compound Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 1-benzylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 140743836 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 1-benzylazetidine-3-carboxylate |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](COC(=O)C3CN(Cc4ccccc4)C3)[C@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C31H42N2O4/c1-21(2)12-24-19-33-11-10-23-14-29(35-3)30(36-4)15-27(23)28(33)13-25(24)20-37-31(34)26-17-32(18-26)16-22-8-6-5-7-9-22/h5-9,14-15,21,24-26,28H,10-13,16-20H2,1-4H3/t24-,25+,28-/m1/s1 |
| InChIKey | UVCZHMDBSWGNIV-CERRFVOPSA-N |
| XLogP | 4.96 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |