C28H45N3O4 — CID 140743841
[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2,2,4-trimethylpiperazine-1-carboxylate (PubChem CID 140743841) has the molecular formula C28H45N3O4 and a molecular weight of 487.69 g/mol. Its IUPAC name is [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2,2,4-trimethylpiperazine-1-carboxylate.
| Compound Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2,2,4-trimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 140743841 |
| Molecular Formula | C28H45N3O4 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.34 |
| IUPAC Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2,2,4-trimethylpiperazine-1-carboxylate |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](COC(=O)N3CCN(C)CC3(C)C)[C@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C28H45N3O4/c1-19(2)12-21-16-30-9-8-20-14-25(33-6)26(34-7)15-23(20)24(30)13-22(21)17-35-27(32)31-11-10-29(5)18-28(31,3)4/h14-15,19,21-22,24H,8-13,16-18H2,1-7H3/t21-,22+,24-/m1/s1 |
| InChIKey | UHFIWKVBBIUKQH-AOHZBQACSA-N |
| XLogP | 4.45 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |