C27H42N2O4 — CID 140743786
[(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-piperidin-3-ylacetate (PubChem CID 140743786) has the molecular formula C27H42N2O4 and a molecular weight of 458.64 g/mol. Its IUPAC name is [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-piperidin-3-ylacetate.
| Compound Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-piperidin-3-ylacetate |
|---|---|
| PubChem CID | 140743786 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | [(2R,3S,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl 2-piperidin-3-ylacetate |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](COC(=O)CC3CCCNC3)[C@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C27H42N2O4/c1-18(2)10-21-16-29-9-7-20-13-25(31-3)26(32-4)14-23(20)24(29)12-22(21)17-33-27(30)11-19-6-5-8-28-15-19/h13-14,18-19,21-22,24,28H,5-12,15-17H2,1-4H3/t19?,21-,22+,24-/m1/s1 |
| InChIKey | SDUQOALQEMPSMM-JUOTZRSISA-N |
| XLogP | 4.22 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |