C19H26FNO3 — CID 140537310
(3R,11bR)-3-(4-fluorobutyl)-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one (PubChem CID 140537310) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is (3R,11bR)-3-(4-fluorobutyl)-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one.
| Compound Name | (3R,11bR)-3-(4-fluorobutyl)-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 140537310 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (3R,11bR)-3-(4-fluorobutyl)-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
| SMILES | COc1cc2c(cc1OC)[C@H]1CC(=O)[C@H](CCCCF)CN1CC2 |
| InChI | InChI=1S/C19H26FNO3/c1-23-18-9-13-6-8-21-12-14(5-3-4-7-20)17(22)11-16(21)15(13)10-19(18)24-2/h9-10,14,16H,3-8,11-12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | XWJAGFWFAKVVCX-GDBMZVCRSA-N |
| XLogP | 3.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|