C20H29NO3 — CID 69034785
3-butyl-9,10-dimethoxy-6-methyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one (PubChem CID 69034785) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-butyl-9,10-dimethoxy-6-methyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one.
| Compound Name | 3-butyl-9,10-dimethoxy-6-methyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 69034785 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-butyl-9,10-dimethoxy-6-methyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
| SMILES | CCCCC1CN2C(C)Cc3cc(OC)c(OC)cc3C2CC1=O |
| InChI | InChI=1S/C20H29NO3/c1-5-6-7-14-12-21-13(2)8-15-9-19(23-3)20(24-4)10-16(15)17(21)11-18(14)22/h9-10,13-14,17H,5-8,11-12H2,1-4H3 |
| InChIKey | YGFRJZONWIIUAK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |