C19H27NO3 — CID 22753163
9,10-diethoxy-3-ethyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one (PubChem CID 22753163) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 9,10-diethoxy-3-ethyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one.
| Compound Name | 9,10-diethoxy-3-ethyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 22753163 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 9,10-diethoxy-3-ethyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
| SMILES | CCOc1cc2c(cc1OCC)C1CC(=O)C(CC)CN1CC2 |
| InChI | InChI=1S/C19H27NO3/c1-4-13-12-20-8-7-14-9-18(22-5-2)19(23-6-3)10-15(14)16(20)11-17(13)21/h9-10,13,16H,4-8,11-12H2,1-3H3 |
| InChIKey | NGEDPGBOCMGJSL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |