C24H28N2O4 — CID 92715470
(11bS)-3-(3,5-dimethylphenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione (PubChem CID 92715470) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (11bS)-3-(3,5-dimethylphenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione.
| Compound Name | (11bS)-3-(3,5-dimethylphenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione |
|---|---|
| PubChem CID | 92715470 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (11bS)-3-(3,5-dimethylphenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione |
| SMILES | CCOc1cc2c(cc1OCC)[C@@H]1CC(=O)N(c3cc(C)cc(C)c3)C(=O)N1CC2 |
| InChI | InChI=1S/C24H28N2O4/c1-5-29-21-12-17-7-8-25-20(19(17)13-22(21)30-6-2)14-23(27)26(24(25)28)18-10-15(3)9-16(4)11-18/h9-13,20H,5-8,14H2,1-4H3/t20-/m0/s1 |
| InChIKey | KVNBROMGOUMZNF-FQEVSTJZSA-N |
| XLogP | 4.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |