C23H24N2O6 — CID 92715485
(11bR)-3-(1,3-benzodioxol-5-yl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione (PubChem CID 92715485) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is (11bR)-3-(1,3-benzodioxol-5-yl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione.
| Compound Name | (11bR)-3-(1,3-benzodioxol-5-yl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione |
|---|---|
| PubChem CID | 92715485 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (11bR)-3-(1,3-benzodioxol-5-yl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1CC(=O)N(c3ccc4c(c3)OCO4)C(=O)N1CC2 |
| InChI | InChI=1S/C23H24N2O6/c1-3-28-19-9-14-7-8-24-17(16(14)11-21(19)29-4-2)12-22(26)25(23(24)27)15-5-6-18-20(10-15)31-13-30-18/h5-6,9-11,17H,3-4,7-8,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | HMKLWMPPRBJFHT-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |