C22H23ClN2O4 — CID 92715467
(11bR)-3-(4-chlorophenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione (PubChem CID 92715467) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is (11bR)-3-(4-chlorophenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione.
| Compound Name | (11bR)-3-(4-chlorophenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione |
|---|---|
| PubChem CID | 92715467 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (11bR)-3-(4-chlorophenyl)-9,10-diethoxy-1,6,7,11b-tetrahydropyrimido[6,1-a]isoquinoline-2,4-dione |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1CC(=O)N(c3ccc(Cl)cc3)C(=O)N1CC2 |
| InChI | InChI=1S/C22H23ClN2O4/c1-3-28-19-11-14-9-10-24-18(17(14)12-20(19)29-4-2)13-21(26)25(22(24)27)16-7-5-15(23)6-8-16/h5-8,11-12,18H,3-4,9-10,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | ZBWCNVOHNOTNPK-GOSISDBHSA-N |
| XLogP | 4.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |