C35H45NO4Si — CID 70667437
(3R,11bR)-3-[6-[hydroxy(diphenyl)silyl]-6-methylheptyl]-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one (PubChem CID 70667437) has the molecular formula C35H45NO4Si and a molecular weight of 571.83 g/mol. Its IUPAC name is (3R,11bR)-3-[6-[hydroxy(diphenyl)silyl]-6-methylheptyl]-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one.
| Compound Name | (3R,11bR)-3-[6-[hydroxy(diphenyl)silyl]-6-methylheptyl]-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 70667437 |
| Molecular Formula | C35H45NO4Si |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | (3R,11bR)-3-[6-[hydroxy(diphenyl)silyl]-6-methylheptyl]-9,10-dimethoxy-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
| SMILES | COc1cc2c(cc1OC)[C@H]1CC(=O)[C@H](CCCCCC(C)(C)[Si](O)(c3ccccc3)c3ccccc3)CN1CC2 |
| InChI | InChI=1S/C35H45NO4Si/c1-35(2,41(38,28-15-9-5-10-16-28)29-17-11-6-12-18-29)20-13-7-8-14-27-25-36-21-19-26-22-33(39-3)34(40-4)23-30(26)31(36)24-32(27)37/h5-6,9-12,15-18,22-23,27,31,38H,7-8,13-14,19-21,24-25H2,1-4H3/t27-,31-/m1/s1 |
| InChIKey | HBSMKKOGVNYMNY-DLFZDVPBSA-N |
| XLogP | 5.67 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|