C20H31N2O4P — CID 134417251
[(2S)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-3-methyl-2-(phosphanylamino)butanoate (PubChem CID 134417251) has the molecular formula C20H31N2O4P and a molecular weight of 394.45 g/mol. Its IUPAC name is [(2S)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-3-methyl-2-(phosphanylamino)butanoate.
| Compound Name | [(2S)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-3-methyl-2-(phosphanylamino)butanoate |
|---|---|
| PubChem CID | 134417251 |
| Molecular Formula | C20H31N2O4P |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(2S)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-3-methyl-2-(phosphanylamino)butanoate |
| SMILES | COc1cc2c(cc1OC)C1C[C@@H](OC(=O)[C@@H](NP)C(C)C)CCN1CC2 |
| InChI | InChI=1S/C20H31N2O4P/c1-12(2)19(21-27)20(23)26-14-6-8-22-7-5-13-9-17(24-3)18(25-4)11-15(13)16(22)10-14/h9,11-12,14,16,19,21H,5-8,10,27H2,1-4H3/t14-,16?,19-/m0/s1 |
| InChIKey | DJJLQZUYHOGNMA-SXUUOERCSA-N |
| XLogP | 2.71 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|