C24H30N2O4 — CID 12940225
N-(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-4-ethoxybenzamide (PubChem CID 12940225) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-4-ethoxybenzamide.
| Compound Name | N-(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 12940225 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC2CCN3CCc4cc(OC)c(OC)cc4C3C2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-4-30-19-7-5-16(6-8-19)24(27)25-18-10-12-26-11-9-17-13-22(28-2)23(29-3)15-20(17)21(26)14-18/h5-8,13,15,18,21H,4,9-12,14H2,1-3H3,(H,25,27) |
| InChIKey | YVHDAVYUMDCPIX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |