C29H34ClN3O4 — CID 23333708
N-[4-[(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)amino]phenyl]-4-methoxybenzamide;hydrochloride (PubChem CID 23333708) has the molecular formula C29H34ClN3O4 and a molecular weight of 524.06 g/mol. Its IUPAC name is N-[4-[(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)amino]phenyl]-4-methoxybenzamide;hydrochloride.
| Compound Name | N-[4-[(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)amino]phenyl]-4-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 23333708 |
| Molecular Formula | C29H34ClN3O4 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | N-[4-[(9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)amino]phenyl]-4-methoxybenzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)Nc2ccc(NC3CCN4CCc5cc(OC)c(OC)cc5C4C3)cc2)cc1.Cl |
| InChI | InChI=1S/C29H33N3O4.ClH/c1-34-24-10-4-19(5-11-24)29(33)31-22-8-6-21(7-9-22)30-23-13-15-32-14-12-20-16-27(35-2)28(36-3)18-25(20)26(32)17-23;/h4-11,16,18,23,26,30H,12-15,17H2,1-3H3,(H,31,33);1H |
| InChIKey | WWGXXDYWGYMNDF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |