C27H36ClNO2 — CID 13050700
[(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] decanoate (PubChem CID 13050700) has the molecular formula C27H36ClNO2 and a molecular weight of 442.04 g/mol. Its IUPAC name is [(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] decanoate.
| Compound Name | [(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] decanoate |
|---|---|
| PubChem CID | 13050700 |
| Molecular Formula | C27H36ClNO2 |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | [(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1cc2c(cc1Cl)CCN(C)C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H36ClNO2/c1-3-4-5-6-7-8-12-15-27(30)31-26-19-23-22(18-25(26)28)16-17-29(2)20-24(23)21-13-10-9-11-14-21/h9-11,13-14,18-19,24H,3-8,12,15-17,20H2,1-2H3/t24-/m0/s1 |
| InChIKey | LCXDZPYWENMSOC-DEOSSOPVSA-N |
| XLogP | 7.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|